C32H46N2O4 — CID 171454283
methyl N-[(1S,2R,4aS,6aR,6bS,8aR,12aS,14aR,14bS)-10-hydroxy-11-isocyano-1,2,6a,6b,9,9,12a-heptamethyl-14-oxo-1,2,3,4,5,6,7,8,8a,12,14a,14b-dodecahydropicen-4a-yl]carbamate (PubChem CID 171454283) has the molecular formula C32H46N2O4 and a molecular weight of 522.73 g/mol. Its IUPAC name is methyl N-[(1S,2R,4aS,6aR,6bS,8aR,12aS,14aR,14bS)-10-hydroxy-11-isocyano-1,2,6a,6b,9,9,12a-heptamethyl-14-oxo-1,2,3,4,5,6,7,8,8a,12,14a,14b-dodecahydropicen-4a-yl]carbamate.
| Compound Name | methyl N-[(1S,2R,4aS,6aR,6bS,8aR,12aS,14aR,14bS)-10-hydroxy-11-isocyano-1,2,6a,6b,9,9,12a-heptamethyl-14-oxo-1,2,3,4,5,6,7,8,8a,12,14a,14b-dodecahydropicen-4a-yl]carbamate |
|---|---|
| PubChem CID | 171454283 |
| Molecular Formula | C32H46N2O4 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.35 |
| IUPAC Name | methyl N-[(1S,2R,4aS,6aR,6bS,8aR,12aS,14aR,14bS)-10-hydroxy-11-isocyano-1,2,6a,6b,9,9,12a-heptamethyl-14-oxo-1,2,3,4,5,6,7,8,8a,12,14a,14b-dodecahydropicen-4a-yl]carbamate |
| SMILES | [C-]#[N+]C1=C(O)C(C)(C)[C@@H]2CC[C@]3(C)C(=CC(=O)[C@@H]4[C@@H]5[C@@H](C)[C@H](C)CC[C@]5(NC(=O)OC)CC[C@]43C)[C@@]2(C)C1 |
| InChI | InChI=1S/C32H46N2O4/c1-18-10-13-32(34-27(37)38-9)15-14-31(7)25(24(32)19(18)2)21(35)16-23-29(5)17-20(33-8)26(36)28(3,4)22(29)11-12-30(23,31)6/h16,18-19,22,24-25,36H,10-15,17H2,1-7,9H3,(H,34,37)/t18-,19+,22+,24+,25-,29+,30-,31-,32+/m1/s1 |
| InChIKey | BXVUHOPAXYTSPA-VPQHEVHVSA-N |
| XLogP | 7.23 |
| TPSA | 79.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|