C31H43NO5 — CID 169018130
methyl (4R,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9,10-dihydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-14-oxo-1,3,4,4a,5,6,7,8,8a,12,14a,14b-dodecahydropicene-4-carboxylate (PubChem CID 169018130) has the molecular formula C31H43NO5 and a molecular weight of 509.69 g/mol. Its IUPAC name is methyl (4R,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9,10-dihydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-14-oxo-1,3,4,4a,5,6,7,8,8a,12,14a,14b-dodecahydropicene-4-carboxylate.
| Compound Name | methyl (4R,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9,10-dihydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-14-oxo-1,3,4,4a,5,6,7,8,8a,12,14a,14b-dodecahydropicene-4-carboxylate |
|---|---|
| PubChem CID | 169018130 |
| Molecular Formula | C31H43NO5 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.31 |
| IUPAC Name | methyl (4R,6aR,6bS,8aR,9R,12aS,14aR,14bR)-9,10-dihydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-14-oxo-1,3,4,4a,5,6,7,8,8a,12,14a,14b-dodecahydropicene-4-carboxylate |
| SMILES | [C-]#[N+]C1=C(O)[C@](C)(O)[C@@H]2CC[C@]3(C)C(=CC(=O)[C@@H]4[C@@H]5CC(C)(C)C[C@@H](C(=O)OC)C5CC[C@]43C)[C@@]2(C)C1 |
| InChI | InChI=1S/C31H43NO5/c1-27(2)14-18-17(19(15-27)26(35)37-8)9-11-30(5)24(18)21(33)13-23-28(3)16-20(32-7)25(34)31(6,36)22(28)10-12-29(23,30)4/h13,17-19,22,24,34,36H,9-12,14-16H2,1-6,8H3/t17?,18-,19-,22-,24+,28+,29-,30-,31-/m1/s1 |
| InChIKey | HBPGVYIPRXTAFA-CHPUURSWSA-N |
| XLogP | 6.02 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|