C32H43NO6 — CID 170137038
methyl (1S,2R,6R,10R,11R,15S,22S)-22-formyloxy-1,2,8,8,15,22-hexamethyl-12-oxo-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-13,17(21),18-triene-6-carboxylate (PubChem CID 170137038) has the molecular formula C32H43NO6 and a molecular weight of 537.70 g/mol. Its IUPAC name is methyl (1S,2R,6R,10R,11R,15S,22S)-22-formyloxy-1,2,8,8,15,22-hexamethyl-12-oxo-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-13,17(21),18-triene-6-carboxylate.
| Compound Name | methyl (1S,2R,6R,10R,11R,15S,22S)-22-formyloxy-1,2,8,8,15,22-hexamethyl-12-oxo-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-13,17(21),18-triene-6-carboxylate |
|---|---|
| PubChem CID | 170137038 |
| Molecular Formula | C32H43NO6 |
| Molecular Weight | 537.70 g/mol |
| Exact Mass | 537.31 |
| IUPAC Name | methyl (1S,2R,6R,10R,11R,15S,22S)-22-formyloxy-1,2,8,8,15,22-hexamethyl-12-oxo-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-13,17(21),18-triene-6-carboxylate |
| SMILES | COC(=O)[C@@H]1CC(C)(C)C[C@@H]2C1CC[C@]1(C)[C@@H]2C(=O)C=C2[C@@]3(C)Cc4cnoc4[C@@](C)(OC=O)C3CC[C@]21C |
| InChI | InChI=1S/C32H43NO6/c1-28(2)14-20-19(21(15-28)27(36)37-7)8-10-31(5)25(20)22(35)12-24-29(3)13-18-16-33-39-26(18)32(6,38-17-34)23(29)9-11-30(24,31)4/h12,16-17,19-21,23,25H,8-11,13-15H2,1-7H3/t19?,20-,21-,23?,25+,29+,30-,31-,32+/m1/s1 |
| InChIKey | MMNOZKRPLXPFJG-BHTXDQEUSA-N |
| XLogP | 5.81 |
| TPSA | 95.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.70 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|