C31H39NO6 — CID 126732963
[(1S,5S,12S,13R,16R,17S,20S,25R)-5,12,16,17,23,23-hexamethyl-2,27-dioxo-10,26-dioxa-9-azaheptacyclo[18.5.2.01,17.04,16.05,13.07,11.020,25]heptacosa-3,7(11),8-trien-12-yl] formate (PubChem CID 126732963) has the molecular formula C31H39NO6 and a molecular weight of 521.65 g/mol. Its IUPAC name is [(1S,5S,12S,13R,16R,17S,20S,25R)-5,12,16,17,23,23-hexamethyl-2,27-dioxo-10,26-dioxa-9-azaheptacyclo[18.5.2.01,17.04,16.05,13.07,11.020,25]heptacosa-3,7(11),8-trien-12-yl] formate.
| Compound Name | [(1S,5S,12S,13R,16R,17S,20S,25R)-5,12,16,17,23,23-hexamethyl-2,27-dioxo-10,26-dioxa-9-azaheptacyclo[18.5.2.01,17.04,16.05,13.07,11.020,25]heptacosa-3,7(11),8-trien-12-yl] formate |
|---|---|
| PubChem CID | 126732963 |
| Molecular Formula | C31H39NO6 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | [(1S,5S,12S,13R,16R,17S,20S,25R)-5,12,16,17,23,23-hexamethyl-2,27-dioxo-10,26-dioxa-9-azaheptacyclo[18.5.2.01,17.04,16.05,13.07,11.020,25]heptacosa-3,7(11),8-trien-12-yl] formate |
| SMILES | CC1(C)CC[C@@]23CC[C@@]4(C)[C@]5(C)CC[C@@H]6[C@](C)(Cc7cnoc7[C@@]6(C)OC=O)C5=CC(=O)[C@]4(OC2=O)[C@@H]3C1 |
| InChI | InChI=1S/C31H39NO6/c1-25(2)9-11-30-12-10-28(5)27(4)8-7-19-26(3,14-18-16-32-38-23(18)29(19,6)36-17-33)20(27)13-22(34)31(28,21(30)15-25)37-24(30)35/h13,16-17,19,21H,7-12,14-15H2,1-6H3/t19-,21-,26+,27-,28+,29+,30+,31-/m1/s1 |
| InChIKey | ARLIDYAELJLORX-FBDMJUOYSA-N |
| XLogP | 5.46 |
| TPSA | 95.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|