C31H39NO5 — CID 123665879
(1S,5S,6R,8R,11R,14R,15S,18S,23R)-8-isocyano-5,10,10,14,15,21,21-heptamethyl-7,24-dioxaheptacyclo[16.5.2.01,15.04,14.05,11.06,8.018,23]pentacos-3-ene-2,9,25-trione (PubChem CID 123665879) has the molecular formula C31H39NO5 and a molecular weight of 505.66 g/mol. Its IUPAC name is (1S,5S,6R,8R,11R,14R,15S,18S,23R)-8-isocyano-5,10,10,14,15,21,21-heptamethyl-7,24-dioxaheptacyclo[16.5.2.01,15.04,14.05,11.06,8.018,23]pentacos-3-ene-2,9,25-trione.
| Compound Name | (1S,5S,6R,8R,11R,14R,15S,18S,23R)-8-isocyano-5,10,10,14,15,21,21-heptamethyl-7,24-dioxaheptacyclo[16.5.2.01,15.04,14.05,11.06,8.018,23]pentacos-3-ene-2,9,25-trione |
|---|---|
| PubChem CID | 123665879 |
| Molecular Formula | C31H39NO5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | (1S,5S,6R,8R,11R,14R,15S,18S,23R)-8-isocyano-5,10,10,14,15,21,21-heptamethyl-7,24-dioxaheptacyclo[16.5.2.01,15.04,14.05,11.06,8.018,23]pentacos-3-ene-2,9,25-trione |
| SMILES | [C-]#[N+][C@@]12O[C@@H]1[C@]1(C)C3=CC(=O)[C@]45OC(=O)[C@@]6(CCC(C)(C)C[C@H]64)CC[C@@]5(C)[C@]3(C)CC[C@H]1C(C)(C)C2=O |
| InChI | InChI=1S/C31H39NO5/c1-24(2)11-13-29-14-12-27(6)26(5)10-9-17-25(3,4)21(34)31(32-8)22(36-31)28(17,7)18(26)15-20(33)30(27,19(29)16-24)37-23(29)35/h15,17,19,22H,9-14,16H2,1-7H3/t17-,19+,22+,26+,27-,28-,29-,30+,31-/m0/s1 |
| InChIKey | MZDGTZDSVOYWFO-XZAKBSHISA-N |
| XLogP | 5.45 |
| TPSA | 77.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|