C32H42FNO4 — CID 162698768
methyl (4aS,6aS,6bR,8aR,12aR,14aS,14bR)-14a-fluoro-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-4a-carboxylate (PubChem CID 162698768) has the molecular formula C32H42FNO4 and a molecular weight of 523.69 g/mol. Its IUPAC name is methyl (4aS,6aS,6bR,8aR,12aR,14aS,14bR)-14a-fluoro-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl (4aS,6aS,6bR,8aR,12aR,14aS,14bR)-14a-fluoro-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 162698768 |
| Molecular Formula | C32H42FNO4 |
| Molecular Weight | 523.69 g/mol |
| Exact Mass | 523.31 |
| IUPAC Name | methyl (4aS,6aS,6bR,8aR,12aR,14aS,14bR)-14a-fluoro-11-isocyano-2,2,6a,6b,9,9,12a-heptamethyl-10,14-dioxo-3,4,5,6,7,8,8a,14b-octahydro-1H-picene-4a-carboxylate |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C@]4(F)[C@@H]5CC(C)(C)CC[C@]5(C(=O)OC)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C32H42FNO4/c1-26(2)12-14-31(25(37)38-9)15-13-30(7)29(6)11-10-20-27(3,4)24(36)19(34-8)17-28(20,5)21(29)16-23(35)32(30,33)22(31)18-26/h16-17,20,22H,10-15,18H2,1-7,9H3/t20-,22+,28-,29+,30-,31-,32+/m0/s1 |
| InChIKey | NMMIASFENNCAAD-MVNVTDFTSA-N |
| XLogP | 6.82 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.69 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|