C31H42LiNO3 — CID 156798207
CID 156798207 (PubChem CID 156798207) has the molecular formula C31H42LiNO3 and a molecular weight of 483.62 g/mol.
| Compound Name | CID 156798207 |
|---|---|
| PubChem CID | 156798207 |
| Molecular Formula | C31H42LiNO3 |
| Molecular Weight | 483.62 g/mol |
| Exact Mass | 483.33 |
| IUPAC Name | — |
| SMILES | CC1(C)CC[C@]2(C=O)CC[C@]3(C)[C@H](C(=O)C=C4[C@@]5(C)Cc6cnoc6C(C)(C)C5CC[C@]43C)[C-]2C1.[Li+] |
| InChI | InChI=1S/C31H42NO3.Li/c1-26(2)10-12-31(18-33)13-11-30(7)24(20(31)16-26)21(34)14-23-28(5)15-19-17-32-35-25(19)27(3,4)22(28)8-9-29(23,30)6;/h14,17-18,22,24H,8-13,15-16H2,1-7H3;/q-1;+1/t22?,24-,28-,29+,30+,31+;/m0./s1 |
| InChIKey | DKJDJEKWANEHRO-ZSJBGODASA-N |
| XLogP | 3.83 |
| TPSA | 60.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.62 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|