C29H41NO2 — CID 70811967
(1S,2R,5S,15S,22S,23S)-1,2,8,8,15,22-hexamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-13,17(21),18-trien-12-one (PubChem CID 70811967) has the molecular formula C29H41NO2 and a molecular weight of 435.65 g/mol. Its IUPAC name is (1S,2R,5S,15S,22S,23S)-1,2,8,8,15,22-hexamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-13,17(21),18-trien-12-one.
| Compound Name | (1S,2R,5S,15S,22S,23S)-1,2,8,8,15,22-hexamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-13,17(21),18-trien-12-one |
|---|---|
| PubChem CID | 70811967 |
| Molecular Formula | C29H41NO2 |
| Molecular Weight | 435.65 g/mol |
| Exact Mass | 435.31 |
| IUPAC Name | (1S,2R,5S,15S,22S,23S)-1,2,8,8,15,22-hexamethyl-20-oxa-19-azahexacyclo[12.11.0.02,11.05,10.015,23.017,21]pentacosa-13,17(21),18-trien-12-one |
| SMILES | C[C@@H]1c2oncc2C[C@]2(C)C3=CC(=O)C4C5CC(C)(C)CC[C@H]5CC[C@@]4(C)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C29H41NO2/c1-17-21-9-12-28(5)23(27(21,4)14-19-16-30-32-25(17)19)13-22(31)24-20-15-26(2,3)10-7-18(20)8-11-29(24,28)6/h13,16-18,20-21,24H,7-12,14-15H2,1-6H3/t17-,18-,20?,21-,24?,27-,28+,29+/m0/s1 |
| InChIKey | RZRQZGFBIZUCLA-QAZAJTRCSA-N |
| XLogP | 7.12 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.65 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |