C31H44O5 — CID 91040646
methyl (6aR,6bS)-11-(hydroxymethyl)-2,2,6a,6b,9,9-hexamethyl-10,14-dioxo-1,3,4,4a,5,6,7,8,8a,11,14a,14b-dodecahydropicene-5-carboxylate (PubChem CID 91040646) has the molecular formula C31H44O5 and a molecular weight of 496.69 g/mol. Its IUPAC name is methyl (6aR,6bS)-11-(hydroxymethyl)-2,2,6a,6b,9,9-hexamethyl-10,14-dioxo-1,3,4,4a,5,6,7,8,8a,11,14a,14b-dodecahydropicene-5-carboxylate.
| Compound Name | methyl (6aR,6bS)-11-(hydroxymethyl)-2,2,6a,6b,9,9-hexamethyl-10,14-dioxo-1,3,4,4a,5,6,7,8,8a,11,14a,14b-dodecahydropicene-5-carboxylate |
|---|---|
| PubChem CID | 91040646 |
| Molecular Formula | C31H44O5 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.32 |
| IUPAC Name | methyl (6aR,6bS)-11-(hydroxymethyl)-2,2,6a,6b,9,9-hexamethyl-10,14-dioxo-1,3,4,4a,5,6,7,8,8a,11,14a,14b-dodecahydropicene-5-carboxylate |
| SMILES | COC(=O)C1C[C@]2(C)C(C(=O)C=C3C4=CC(CO)C(=O)C(C)(C)C4CC[C@]32C)C2CC(C)(C)CCC12 |
| InChI | InChI=1S/C31H44O5/c1-28(2)10-8-18-20(14-28)25-24(33)13-23-19-12-17(16-32)26(34)29(3,4)22(19)9-11-30(23,5)31(25,6)15-21(18)27(35)36-7/h12-13,17-18,20-22,25,32H,8-11,14-16H2,1-7H3/t17?,18?,20?,21?,22?,25?,30-,31-/m1/s1 |
| InChIKey | BHFGROKROBECIA-QBEGFUHQSA-N |
| XLogP | 5.31 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |