C32H44N2O4 — CID 169018161
(4R,6aR,6bS,8aR,9S,12aS,14aR,14bR)-N-ethyl-9-hydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,4a,5,6,7,8,8a,14a,14b-decahydro-1H-picene-4-carboxamide (PubChem CID 169018161) has the molecular formula C32H44N2O4 and a molecular weight of 520.71 g/mol. Its IUPAC name is (4R,6aR,6bS,8aR,9S,12aS,14aR,14bR)-N-ethyl-9-hydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,4a,5,6,7,8,8a,14a,14b-decahydro-1H-picene-4-carboxamide.
| Compound Name | (4R,6aR,6bS,8aR,9S,12aS,14aR,14bR)-N-ethyl-9-hydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,4a,5,6,7,8,8a,14a,14b-decahydro-1H-picene-4-carboxamide |
|---|---|
| PubChem CID | 169018161 |
| Molecular Formula | C32H44N2O4 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | (4R,6aR,6bS,8aR,9S,12aS,14aR,14bR)-N-ethyl-9-hydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-10,14-dioxo-3,4,4a,5,6,7,8,8a,14a,14b-decahydro-1H-picene-4-carboxamide |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C@@H]4[C@@H]5CC(C)(C)C[C@@H](C(=O)NCC)C5CC[C@@]4(C)[C@]3(C)CC[C@H]2[C@](C)(O)C1=O |
| InChI | InChI=1S/C32H44N2O4/c1-9-34-27(37)20-16-28(2,3)15-19-18(20)10-12-31(6)25(19)22(35)14-24-29(4)17-21(33-8)26(36)32(7,38)23(29)11-13-30(24,31)5/h14,17-20,23,25,38H,9-13,15-16H2,1-7H3,(H,34,37)/t18?,19-,20-,23-,25+,29+,30-,31-,32+/m1/s1 |
| InChIKey | ZRGSZRNHNYSSQM-FFWZWCIESA-N |
| XLogP | 5.28 |
| TPSA | 87.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|