C33H46FN5O2 — CID 155791510
(4aR,6aR,6aS,6bR,8aS,12aS,14bS)-8a-[2-(2-fluoroethyl)tetrazol-5-yl]-3-hydroxy-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-4a,5,6,6a,7,8,9,10,12,12a-decahydro-1H-picen-13-one (PubChem CID 155791510) has the molecular formula C33H46FN5O2 and a molecular weight of 563.76 g/mol. Its IUPAC name is (4aR,6aR,6aS,6bR,8aS,12aS,14bS)-8a-[2-(2-fluoroethyl)tetrazol-5-yl]-3-hydroxy-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-4a,5,6,6a,7,8,9,10,12,12a-decahydro-1H-picen-13-one.
| Compound Name | (4aR,6aR,6aS,6bR,8aS,12aS,14bS)-8a-[2-(2-fluoroethyl)tetrazol-5-yl]-3-hydroxy-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-4a,5,6,6a,7,8,9,10,12,12a-decahydro-1H-picen-13-one |
|---|---|
| PubChem CID | 155791510 |
| Molecular Formula | C33H46FN5O2 |
| Molecular Weight | 563.76 g/mol |
| Exact Mass | 563.36 |
| IUPAC Name | (4aR,6aR,6aS,6bR,8aS,12aS,14bS)-8a-[2-(2-fluoroethyl)tetrazol-5-yl]-3-hydroxy-2-isocyano-4,4,6a,6b,11,11,14b-heptamethyl-4a,5,6,6a,7,8,9,10,12,12a-decahydro-1H-picen-13-one |
| SMILES | [C-]#[N+]C1=C(O)C(C)(C)[C@@H]2CC[C@]3(C)C(=CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(c5nnn(CCF)n5)CC[C@]43C)[C@@]2(C)C1 |
| InChI | InChI=1S/C33H46FN5O2/c1-28(2)11-13-33(27-36-38-39(37-27)16-15-34)14-12-32(7)25(20(33)18-28)22(40)17-24-30(5)19-21(35-8)26(41)29(3,4)23(30)9-10-31(24,32)6/h17,20,23,25,41H,9-16,18-19H2,1-7H3/t20-,23-,25-,30-,31+,32+,33-/m0/s1 |
| InChIKey | SMYGFKAFWNUDQN-VFZQLLPWSA-N |
| XLogP | 7.17 |
| TPSA | 85.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.76 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|