C31H45NO2 — CID 158285776
(4aR,6aR,6aS,6bR,8aR,12aS,14bS)-2-isocyano-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,4a,5,6,6a,7,8,9,10,12,12a-dodecahydropicene-3,13-dione (PubChem CID 158285776) has the molecular formula C31H45NO2 and a molecular weight of 463.71 g/mol. Its IUPAC name is (4aR,6aR,6aS,6bR,8aR,12aS,14bS)-2-isocyano-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,4a,5,6,6a,7,8,9,10,12,12a-dodecahydropicene-3,13-dione.
| Compound Name | (4aR,6aR,6aS,6bR,8aR,12aS,14bS)-2-isocyano-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,4a,5,6,6a,7,8,9,10,12,12a-dodecahydropicene-3,13-dione |
|---|---|
| PubChem CID | 158285776 |
| Molecular Formula | C31H45NO2 |
| Molecular Weight | 463.71 g/mol |
| Exact Mass | 463.35 |
| IUPAC Name | (4aR,6aR,6aS,6bR,8aR,12aS,14bS)-2-isocyano-4,4,6a,6b,8a,11,11,14b-octamethyl-1,2,4a,5,6,6a,7,8,9,10,12,12a-dodecahydropicene-3,13-dione |
| SMILES | [C-]#[N+]C1C[C@]2(C)C3=CC(=O)[C@@H]4[C@@H]5CC(C)(C)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C31H45NO2/c1-26(2)12-13-28(5)14-15-31(8)24(19(28)17-26)21(33)16-23-29(6)18-20(32-9)25(34)27(3,4)22(29)10-11-30(23,31)7/h16,19-20,22,24H,10-15,17-18H2,1-8H3/t19-,20?,22-,24-,28+,29-,30+,31+/m0/s1 |
| InChIKey | XBKKONBQGOODBF-FYDAYVCWSA-N |
| XLogP | 7.45 |
| TPSA | 38.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.71 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|