C30H42O3 — CID 135334228
(1S,2R,5R,10S,11R,15S,21R)-1,2,5,8,8,15,20,20-octamethyl-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricosa-13,16(18)-diene-12,19-dione (PubChem CID 135334228) has the molecular formula C30H42O3 and a molecular weight of 450.66 g/mol. Its IUPAC name is (1S,2R,5R,10S,11R,15S,21R)-1,2,5,8,8,15,20,20-octamethyl-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricosa-13,16(18)-diene-12,19-dione.
| Compound Name | (1S,2R,5R,10S,11R,15S,21R)-1,2,5,8,8,15,20,20-octamethyl-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricosa-13,16(18)-diene-12,19-dione |
|---|---|
| PubChem CID | 135334228 |
| Molecular Formula | C30H42O3 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | (1S,2R,5R,10S,11R,15S,21R)-1,2,5,8,8,15,20,20-octamethyl-17-oxahexacyclo[12.9.0.02,11.05,10.015,21.016,18]tricosa-13,16(18)-diene-12,19-dione |
| SMILES | CC1(C)CC[C@]2(C)CC[C@]3(C)[C@H](C(=O)C=C4[C@@]5(C)C6=C(O6)C(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C30H42O3/c1-25(2)11-12-27(5)13-14-29(7)21(17(27)16-25)18(31)15-20-28(29,6)10-9-19-26(3,4)23(32)22-24(33-22)30(19,20)8/h15,17,19,21H,9-14,16H2,1-8H3/t17-,19-,21-,27+,28+,29+,30-/m0/s1 |
| InChIKey | WCQNMJYPEFCPJH-AKUTZDIWSA-N |
| XLogP | 7.02 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |