C33H43N3O3 — CID 162698680
(4aR,6aR,6aS,6bR,8aS,11S,12aS,14bR)-2-isocyano-4,4,6a,6b,8a,11,14b-heptamethyl-11-(5-methyl-1,3,4-oxadiazol-2-yl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione (PubChem CID 162698680) has the molecular formula C33H43N3O3 and a molecular weight of 529.73 g/mol. Its IUPAC name is (4aR,6aR,6aS,6bR,8aS,11S,12aS,14bR)-2-isocyano-4,4,6a,6b,8a,11,14b-heptamethyl-11-(5-methyl-1,3,4-oxadiazol-2-yl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione.
| Compound Name | (4aR,6aR,6aS,6bR,8aS,11S,12aS,14bR)-2-isocyano-4,4,6a,6b,8a,11,14b-heptamethyl-11-(5-methyl-1,3,4-oxadiazol-2-yl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione |
|---|---|
| PubChem CID | 162698680 |
| Molecular Formula | C33H43N3O3 |
| Molecular Weight | 529.73 g/mol |
| Exact Mass | 529.33 |
| IUPAC Name | (4aR,6aR,6aS,6bR,8aS,11S,12aS,14bR)-2-isocyano-4,4,6a,6b,8a,11,14b-heptamethyl-11-(5-methyl-1,3,4-oxadiazol-2-yl)-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C@@H]4[C@@H]5C[C@@](C)(c6nnc(C)o6)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C33H43N3O3/c1-19-35-36-27(39-19)30(5)13-12-29(4)14-15-33(8)25(20(29)17-30)22(37)16-24-31(6)18-21(34-9)26(38)28(2,3)23(31)10-11-32(24,33)7/h16,18,20,23,25H,10-15,17H2,1-8H3/t20-,23-,25-,29+,30-,31-,32+,33+/m0/s1 |
| InChIKey | ZYABAFFQZYHYAA-TYSCDVASSA-N |
| XLogP | 7.20 |
| TPSA | 77.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.73 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|