C34H48N2O2 — CID 162698757
(4aR,6aR,6aS,6bR,8aS,11S,12aS,14bR)-2-isocyano-4,4,6a,6b,8a,11,14b-heptamethyl-11-pyrrolidin-1-yl-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione (PubChem CID 162698757) has the molecular formula C34H48N2O2 and a molecular weight of 516.77 g/mol. Its IUPAC name is (4aR,6aR,6aS,6bR,8aS,11S,12aS,14bR)-2-isocyano-4,4,6a,6b,8a,11,14b-heptamethyl-11-pyrrolidin-1-yl-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione.
| Compound Name | (4aR,6aR,6aS,6bR,8aS,11S,12aS,14bR)-2-isocyano-4,4,6a,6b,8a,11,14b-heptamethyl-11-pyrrolidin-1-yl-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione |
|---|---|
| PubChem CID | 162698757 |
| Molecular Formula | C34H48N2O2 |
| Molecular Weight | 516.77 g/mol |
| Exact Mass | 516.37 |
| IUPAC Name | (4aR,6aR,6aS,6bR,8aS,11S,12aS,14bR)-2-isocyano-4,4,6a,6b,8a,11,14b-heptamethyl-11-pyrrolidin-1-yl-4a,5,6,6a,7,8,9,10,12,12a-decahydropicene-3,13-dione |
| SMILES | [C-]#[N+]C1=C[C@]2(C)C3=CC(=O)[C@@H]4[C@@H]5C[C@@](C)(N6CCCC6)CC[C@]5(C)CC[C@@]4(C)[C@]3(C)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C34H48N2O2/c1-29(2)25-11-12-33(6)26(32(25,5)21-23(35-8)28(29)38)19-24(37)27-22-20-31(4,36-17-9-10-18-36)15-13-30(22,3)14-16-34(27,33)7/h19,21-22,25,27H,9-18,20H2,1-7H3/t22-,25-,27-,30+,31-,32-,33+,34+/m0/s1 |
| InChIKey | JBHMSCXKJVNNQS-WPSOQMOASA-N |
| XLogP | 7.41 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.77 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|