C19H22N2O2 — CID 58802205
(4aS,8aR,10aR)-2-hydroxy-3-isocyano-1,1,4a-trimethyl-6-oxo-4,7,8,9,10,10a-hexahydrophenanthrene-8a-carbonitrile (PubChem CID 58802205) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is (4aS,8aR,10aR)-2-hydroxy-3-isocyano-1,1,4a-trimethyl-6-oxo-4,7,8,9,10,10a-hexahydrophenanthrene-8a-carbonitrile.
| Compound Name | (4aS,8aR,10aR)-2-hydroxy-3-isocyano-1,1,4a-trimethyl-6-oxo-4,7,8,9,10,10a-hexahydrophenanthrene-8a-carbonitrile |
|---|---|
| PubChem CID | 58802205 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | (4aS,8aR,10aR)-2-hydroxy-3-isocyano-1,1,4a-trimethyl-6-oxo-4,7,8,9,10,10a-hexahydrophenanthrene-8a-carbonitrile |
| SMILES | [C-]#[N+]C1=C(O)C(C)(C)[C@@H]2CC[C@@]3(C#N)CCC(=O)C=C3[C@@]2(C)C1 |
| InChI | InChI=1S/C19H22N2O2/c1-17(2)14-6-8-19(11-20)7-5-12(22)9-15(19)18(14,3)10-13(21-4)16(17)23/h9,14,23H,5-8,10H2,1-3H3/t14-,18-,19+/m0/s1 |
| InChIKey | HLCWXLKVQFMWQG-ZOCIIQOWSA-N |
| XLogP | 4.32 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|