C19H25NO3 — CID 58802154
(4aR,6aR,11aS)-4a-(hydroxymethyl)-7,7,11a-trimethyl-3,4,5,6,6a,11-hexahydronaphtho[1,2-f][1,2]benzoxazol-2-one (PubChem CID 58802154) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (4aR,6aR,11aS)-4a-(hydroxymethyl)-7,7,11a-trimethyl-3,4,5,6,6a,11-hexahydronaphtho[1,2-f][1,2]benzoxazol-2-one.
| Compound Name | (4aR,6aR,11aS)-4a-(hydroxymethyl)-7,7,11a-trimethyl-3,4,5,6,6a,11-hexahydronaphtho[1,2-f][1,2]benzoxazol-2-one |
|---|---|
| PubChem CID | 58802154 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (4aR,6aR,11aS)-4a-(hydroxymethyl)-7,7,11a-trimethyl-3,4,5,6,6a,11-hexahydronaphtho[1,2-f][1,2]benzoxazol-2-one |
| SMILES | CC1(C)c2oncc2C[C@]2(C)C3=CC(=O)CC[C@]3(CO)CC[C@@H]12 |
| InChI | InChI=1S/C19H25NO3/c1-17(2)14-5-7-19(11-21)6-4-13(22)8-15(19)18(14,3)9-12-10-20-23-16(12)17/h8,10,14,21H,4-7,9,11H2,1-3H3/t14-,18-,19+/m0/s1 |
| InChIKey | VGSGHOHOYJNASJ-ZOCIIQOWSA-N |
| XLogP | 3.19 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |