C15H19N3O — CID 163693771
(5aR)-6,6,10a-trimethyl-4,5,5a,10-tetrahydro-1H-indazolo[7,6-f][1,2]benzoxazole (PubChem CID 163693771) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is (5aR)-6,6,10a-trimethyl-4,5,5a,10-tetrahydro-1H-indazolo[7,6-f][1,2]benzoxazole.
| Compound Name | (5aR)-6,6,10a-trimethyl-4,5,5a,10-tetrahydro-1H-indazolo[7,6-f][1,2]benzoxazole |
|---|---|
| PubChem CID | 163693771 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | (5aR)-6,6,10a-trimethyl-4,5,5a,10-tetrahydro-1H-indazolo[7,6-f][1,2]benzoxazole |
| SMILES | CC1(C)c2oncc2CC2(C)c3[nH]ncc3CC[C@@H]12 |
| InChI | InChI=1S/C15H19N3O/c1-14(2)11-5-4-9-7-16-18-12(9)15(11,3)6-10-8-17-19-13(10)14/h7-8,11H,4-6H2,1-3H3,(H,16,18)/t11-,15?/m0/s1 |
| InChIKey | JVEZRNRXLNNCEM-VPHXOMNUSA-N |
| XLogP | 2.75 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |