C23H30N2O — CID 155139374
(4aR,6S,8aR)-6-(3,4-dihydro-1H-isoquinolin-2-yl)-4a,9,9-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1,2]benzoxazole (PubChem CID 155139374) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is (4aR,6S,8aR)-6-(3,4-dihydro-1H-isoquinolin-2-yl)-4a,9,9-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1,2]benzoxazole.
| Compound Name | (4aR,6S,8aR)-6-(3,4-dihydro-1H-isoquinolin-2-yl)-4a,9,9-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1,2]benzoxazole |
|---|---|
| PubChem CID | 155139374 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (4aR,6S,8aR)-6-(3,4-dihydro-1H-isoquinolin-2-yl)-4a,9,9-trimethyl-4,5,6,7,8,8a-hexahydrobenzo[f][1,2]benzoxazole |
| SMILES | CC1(C)c2oncc2C[C@]2(C)C[C@@H](N3CCc4ccccc4C3)CC[C@@H]12 |
| InChI | InChI=1S/C23H30N2O/c1-22(2)20-9-8-19(13-23(20,3)12-18-14-24-26-21(18)22)25-11-10-16-6-4-5-7-17(16)15-25/h4-7,14,19-20H,8-13,15H2,1-3H3/t19-,20-,23+/m0/s1 |
| InChIKey | WQKXOPBXOGWQEH-SXWKCWPCSA-N |
| XLogP | 4.74 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |