C19H25NO3 — CID 142265697
(4aS,8aR)-2-hydroxy-8a-(hydroxymethyl)-1,1,4a-trimethyl-6-oxo-2,7,8,9,10,10a-hexahydrophenanthrene-3-carbonitrile (PubChem CID 142265697) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (4aS,8aR)-2-hydroxy-8a-(hydroxymethyl)-1,1,4a-trimethyl-6-oxo-2,7,8,9,10,10a-hexahydrophenanthrene-3-carbonitrile.
| Compound Name | (4aS,8aR)-2-hydroxy-8a-(hydroxymethyl)-1,1,4a-trimethyl-6-oxo-2,7,8,9,10,10a-hexahydrophenanthrene-3-carbonitrile |
|---|---|
| PubChem CID | 142265697 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (4aS,8aR)-2-hydroxy-8a-(hydroxymethyl)-1,1,4a-trimethyl-6-oxo-2,7,8,9,10,10a-hexahydrophenanthrene-3-carbonitrile |
| SMILES | CC1(C)C(O)C(C#N)=C[C@]2(C)C3=CC(=O)CC[C@]3(CO)CCC12 |
| InChI | InChI=1S/C19H25NO3/c1-17(2)14-5-7-19(11-21)6-4-13(22)8-15(19)18(14,3)9-12(10-20)16(17)23/h8-9,14,16,21,23H,4-7,11H2,1-3H3/t14?,16?,18-,19+/m0/s1 |
| InChIKey | XBMJSBFFQLQPAC-NHSGJMAASA-N |
| XLogP | 2.52 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |