C33H50NO5P — CID 146506162
(4aR,6aR,6aS,6bR,8aS,12aS,14bS)-8a-(dimethoxyphosphorylmethyl)-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a-decahydro-3H-picene-2-carbonitrile (PubChem CID 146506162) has the molecular formula C33H50NO5P and a molecular weight of 571.74 g/mol. Its IUPAC name is (4aR,6aR,6aS,6bR,8aS,12aS,14bS)-8a-(dimethoxyphosphorylmethyl)-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a-decahydro-3H-picene-2-carbonitrile.
| Compound Name | (4aR,6aR,6aS,6bR,8aS,12aS,14bS)-8a-(dimethoxyphosphorylmethyl)-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a-decahydro-3H-picene-2-carbonitrile |
|---|---|
| PubChem CID | 146506162 |
| Molecular Formula | C33H50NO5P |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.34 |
| IUPAC Name | (4aR,6aR,6aS,6bR,8aS,12aS,14bS)-8a-(dimethoxyphosphorylmethyl)-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a-decahydro-3H-picene-2-carbonitrile |
| SMILES | COP(=O)(C[C@]12CCC(C)(C)C[C@H]1[C@H]1C(=O)C=C3[C@@]4(C)C=C(C#N)C(O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2)OC |
| InChI | InChI=1S/C33H50NO5P/c1-28(2)12-14-33(20-40(37,38-8)39-9)15-13-32(7)26(22(33)18-28)23(35)16-25-30(5)17-21(19-34)27(36)29(3,4)24(30)10-11-31(25,32)6/h16-17,22,24,26-27,36H,10-15,18,20H2,1-9H3/t22-,24-,26-,27?,30-,31+,32+,33+/m0/s1 |
| InChIKey | RQCFYGHJNQEBTF-VCEVVPIVSA-N |
| XLogP | 7.48 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|