C32H48N2O2 — CID 155021726
(4aR,6aR,6aS,6bR,8aS,12aS,14bS)-8a-(dimethylamino)-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a-decahydro-3H-picene-2-carbonitrile (PubChem CID 155021726) has the molecular formula C32H48N2O2 and a molecular weight of 492.75 g/mol. Its IUPAC name is (4aR,6aR,6aS,6bR,8aS,12aS,14bS)-8a-(dimethylamino)-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a-decahydro-3H-picene-2-carbonitrile.
| Compound Name | (4aR,6aR,6aS,6bR,8aS,12aS,14bS)-8a-(dimethylamino)-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a-decahydro-3H-picene-2-carbonitrile |
|---|---|
| PubChem CID | 155021726 |
| Molecular Formula | C32H48N2O2 |
| Molecular Weight | 492.75 g/mol |
| Exact Mass | 492.37 |
| IUPAC Name | (4aR,6aR,6aS,6bR,8aS,12aS,14bS)-8a-(dimethylamino)-3-hydroxy-4,4,6a,6b,11,11,14b-heptamethyl-13-oxo-4a,5,6,6a,7,8,9,10,12,12a-decahydro-3H-picene-2-carbonitrile |
| SMILES | CN(C)[C@]12CCC(C)(C)C[C@H]1[C@H]1C(=O)C=C3[C@@]4(C)C=C(C#N)C(O)C(C)(C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C32H48N2O2/c1-27(2)12-14-32(34(8)9)15-13-31(7)25(21(32)18-27)22(35)16-24-29(5)17-20(19-33)26(36)28(3,4)23(29)10-11-30(24,31)6/h16-17,21,23,25-26,36H,10-15,18H2,1-9H3/t21-,23-,25-,26?,29-,30+,31+,32-/m0/s1 |
| InChIKey | MVCAJOCSSZSXDQ-LMZYNOIJSA-N |
| XLogP | 6.31 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.75 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |