C18H28O2 — CID 59826471
8a-(hydroxymethyl)-1,1,4a-trimethyl-3,4,6,7,8,9,10,10a-octahydrophenanthren-2-one (PubChem CID 59826471) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 8a-(hydroxymethyl)-1,1,4a-trimethyl-3,4,6,7,8,9,10,10a-octahydrophenanthren-2-one.
| Compound Name | 8a-(hydroxymethyl)-1,1,4a-trimethyl-3,4,6,7,8,9,10,10a-octahydrophenanthren-2-one |
|---|---|
| PubChem CID | 59826471 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 8a-(hydroxymethyl)-1,1,4a-trimethyl-3,4,6,7,8,9,10,10a-octahydrophenanthren-2-one |
| SMILES | CC1(C)C(=O)CCC2(C)C3=CCCCC3(CO)CCC12 |
| InChI | InChI=1S/C18H28O2/c1-16(2)13-7-11-18(12-19)9-5-4-6-14(18)17(13,3)10-8-15(16)20/h6,13,19H,4-5,7-12H2,1-3H3 |
| InChIKey | UZXHDDWWXSUKEZ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|