C19H26O4 — CID 163746614
methyl (8aR)-1,1,4a-trimethyl-2,6-dioxo-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-8a-carboxylate (PubChem CID 163746614) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is methyl (8aR)-1,1,4a-trimethyl-2,6-dioxo-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-8a-carboxylate.
| Compound Name | methyl (8aR)-1,1,4a-trimethyl-2,6-dioxo-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-8a-carboxylate |
|---|---|
| PubChem CID | 163746614 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | methyl (8aR)-1,1,4a-trimethyl-2,6-dioxo-4,7,8,9,10,10a-hexahydro-3H-phenanthrene-8a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(=O)C=C1C1(C)CCC(=O)C(C)(C)C1CC2 |
| InChI | InChI=1S/C19H26O4/c1-17(2)13-6-10-19(16(22)23-4)9-5-12(20)11-14(19)18(13,3)8-7-15(17)21/h11,13H,5-10H2,1-4H3/t13?,18?,19-/m0/s1 |
| InChIKey | LMKVZPABORGFMH-PSMHFXKOSA-N |
| XLogP | 3.24 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |