C18H22O2 — CID 144717043
8a-ethynyl-1,4a-dimethyl-1,3,4,7,8,9,10,10a-octahydrophenanthrene-2,6-dione (PubChem CID 144717043) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 8a-ethynyl-1,4a-dimethyl-1,3,4,7,8,9,10,10a-octahydrophenanthrene-2,6-dione.
| Compound Name | 8a-ethynyl-1,4a-dimethyl-1,3,4,7,8,9,10,10a-octahydrophenanthrene-2,6-dione |
|---|---|
| PubChem CID | 144717043 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 8a-ethynyl-1,4a-dimethyl-1,3,4,7,8,9,10,10a-octahydrophenanthrene-2,6-dione |
| SMILES | C#CC12CCC(=O)C=C1C1(C)CCC(=O)C(C)C1CC2 |
| InChI | InChI=1S/C18H22O2/c1-4-18-9-5-13(19)11-16(18)17(3)8-7-15(20)12(2)14(17)6-10-18/h1,11-12,14H,5-10H2,2-3H3 |
| InChIKey | SCPCLHGDCGEDTC-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|