C19H24F4O — CID 154141174
(8R,9S,10R,13S,14S)-6,6,17,17-tetrafluoro-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 154141174) has the molecular formula C19H24F4O and a molecular weight of 344.39 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-6,6,17,17-tetrafluoro-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S)-6,6,17,17-tetrafluoro-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 154141174 |
| Molecular Formula | C19H24F4O |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (8R,9S,10R,13S,14S)-6,6,17,17-tetrafluoro-10,13-dimethyl-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1C(F)(F)C[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CCC2(F)F |
| InChI | InChI=1S/C19H24F4O/c1-16-6-3-11(24)9-15(16)18(20,21)10-12-13(16)4-7-17(2)14(12)5-8-19(17,22)23/h9,12-14H,3-8,10H2,1-2H3/t12-,13+,14+,16-,17+/m1/s1 |
| InChIKey | WNLKODMPIZRSIR-PYOKUCOHSA-N |
| XLogP | 5.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |