C23H32F2O4 — CID 154161292
2-[(8R,9S,10R,13S,14S,17S)-6,6-difluoro-17-hydroxy-10,13-dimethyl-3-oxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethyl acetate (PubChem CID 154161292) has the molecular formula C23H32F2O4 and a molecular weight of 410.50 g/mol. Its IUPAC name is 2-[(8R,9S,10R,13S,14S,17S)-6,6-difluoro-17-hydroxy-10,13-dimethyl-3-oxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethyl acetate.
| Compound Name | 2-[(8R,9S,10R,13S,14S,17S)-6,6-difluoro-17-hydroxy-10,13-dimethyl-3-oxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethyl acetate |
|---|---|
| PubChem CID | 154161292 |
| Molecular Formula | C23H32F2O4 |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 2-[(8R,9S,10R,13S,14S,17S)-6,6-difluoro-17-hydroxy-10,13-dimethyl-3-oxo-1,2,7,8,9,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-17-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@@]1(O)CC[C@H]2[C@@H]3CC(F)(F)C4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C23H32F2O4/c1-14(26)29-11-10-22(28)9-6-18-16-13-23(24,25)19-12-15(27)4-7-20(19,2)17(16)5-8-21(18,22)3/h12,16-18,28H,4-11,13H2,1-3H3/t16-,17+,18+,20-,21+,22+/m1/s1 |
| InChIKey | GZHAIVPCIUYJBA-NWUMPJBXSA-N |
| XLogP | 4.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |