C30H27N3O2 — CID 161366366
1H-indole;6-isocyano-4b,8,8-trimethyl-3,7-dioxo-10a-prop-1-ynyl-9,10-dihydro-8aH-phenanthrene-2-carbonitrile (PubChem CID 161366366) has the molecular formula C30H27N3O2 and a molecular weight of 461.57 g/mol. Its IUPAC name is 1H-indole;6-isocyano-4b,8,8-trimethyl-3,7-dioxo-10a-prop-1-ynyl-9,10-dihydro-8aH-phenanthrene-2-carbonitrile.
| Compound Name | 1H-indole;6-isocyano-4b,8,8-trimethyl-3,7-dioxo-10a-prop-1-ynyl-9,10-dihydro-8aH-phenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 161366366 |
| Molecular Formula | C30H27N3O2 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 1H-indole;6-isocyano-4b,8,8-trimethyl-3,7-dioxo-10a-prop-1-ynyl-9,10-dihydro-8aH-phenanthrene-2-carbonitrile |
| SMILES | [C-]#[N+]C1=CC2(C)C3=CC(=O)C(C#N)=CC3(C#CC)CCC2C(C)(C)C1=O.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C22H20N2O2.C8H7N/c1-6-8-22-9-7-17-20(2,3)19(26)15(24-5)12-21(17,4)18(22)10-16(25)14(11-22)13-23;1-2-4-8-7(3-1)5-6-9-8/h10-12,17H,7,9H2,1-4H3;1-6,9H |
| InChIKey | VPWDAAIDKCUQSG-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 78.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|