C28H26N2O2 — CID 24956905
8a-[2-(1H-indol-6-yl)ethynyl]-1,1,4a-trimethyl-2,6-dioxo-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile (PubChem CID 24956905) has the molecular formula C28H26N2O2 and a molecular weight of 422.53 g/mol. Its IUPAC name is 8a-[2-(1H-indol-6-yl)ethynyl]-1,1,4a-trimethyl-2,6-dioxo-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile.
| Compound Name | 8a-[2-(1H-indol-6-yl)ethynyl]-1,1,4a-trimethyl-2,6-dioxo-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile |
|---|---|
| PubChem CID | 24956905 |
| Molecular Formula | C28H26N2O2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 8a-[2-(1H-indol-6-yl)ethynyl]-1,1,4a-trimethyl-2,6-dioxo-8,9,10,10a-tetrahydro-7H-phenanthrene-3-carbonitrile |
| SMILES | CC1(C)C(=O)C(C#N)=CC2(C)C3=CC(=O)CCC3(C#Cc3ccc4cc[nH]c4c3)CCC12 |
| InChI | InChI=1S/C28H26N2O2/c1-26(2)23-8-12-28(10-6-18-4-5-19-9-13-30-22(19)14-18)11-7-21(31)15-24(28)27(23,3)16-20(17-29)25(26)32/h4-5,9,13-16,23,30H,7-8,11-12H2,1-3H3 |
| InChIKey | USYPBQZXFHWDRL-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|