C24H20N2O2 — CID 58100914
6-isocyano-4b,8,8-trimethyl-3,7-dioxo-1-penta-1,3-diynyl-8a,9,10,10a-tetrahydrophenanthrene-2-carbonitrile (PubChem CID 58100914) has the molecular formula C24H20N2O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 6-isocyano-4b,8,8-trimethyl-3,7-dioxo-1-penta-1,3-diynyl-8a,9,10,10a-tetrahydrophenanthrene-2-carbonitrile.
| Compound Name | 6-isocyano-4b,8,8-trimethyl-3,7-dioxo-1-penta-1,3-diynyl-8a,9,10,10a-tetrahydrophenanthrene-2-carbonitrile |
|---|---|
| PubChem CID | 58100914 |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 6-isocyano-4b,8,8-trimethyl-3,7-dioxo-1-penta-1,3-diynyl-8a,9,10,10a-tetrahydrophenanthrene-2-carbonitrile |
| SMILES | [C-]#[N+]C1=CC2(C)C3=CC(=O)C(C#N)=C(C#CC#CC)C3CCC2C(C)(C)C1=O |
| InChI | InChI=1S/C24H20N2O2/c1-6-7-8-9-15-16-10-11-21-23(2,3)22(28)19(26-5)13-24(21,4)18(16)12-20(27)17(15)14-25/h12-13,16,21H,10-11H2,1-4H3 |
| InChIKey | DKUGRKOACMXTKN-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 62.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|