C30H39NO5 — CID 138568072
methyl (4aS,6aS,6bR,8aR,9S,14aS)-11-cyano-14a-hydroxy-2,2,6a,6b,9-pentamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,12a,14b-decahydro-1H-picene-4a-carboxylate (PubChem CID 138568072) has the molecular formula C30H39NO5 and a molecular weight of 493.64 g/mol. Its IUPAC name is methyl (4aS,6aS,6bR,8aR,9S,14aS)-11-cyano-14a-hydroxy-2,2,6a,6b,9-pentamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,12a,14b-decahydro-1H-picene-4a-carboxylate.
| Compound Name | methyl (4aS,6aS,6bR,8aR,9S,14aS)-11-cyano-14a-hydroxy-2,2,6a,6b,9-pentamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,12a,14b-decahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 138568072 |
| Molecular Formula | C30H39NO5 |
| Molecular Weight | 493.64 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | methyl (4aS,6aS,6bR,8aR,9S,14aS)-11-cyano-14a-hydroxy-2,2,6a,6b,9-pentamethyl-10,14-dioxo-3,4,5,6,7,8,8a,9,12a,14b-decahydro-1H-picene-4a-carboxylate |
| SMILES | COC(=O)[C@]12CCC(C)(C)CC1[C@@]1(O)C(=O)C=C3C4C=C(C#N)C(=O)[C@@H](C)[C@@H]4CC[C@@]3(C)[C@]1(C)CC2 |
| InChI | InChI=1S/C30H39NO5/c1-17-19-7-8-27(4)21(20(19)13-18(16-31)24(17)33)14-23(32)30(35)22-15-26(2,3)9-11-29(22,25(34)36-6)12-10-28(27,30)5/h13-14,17,19-20,22,35H,7-12,15H2,1-6H3/t17-,19-,20?,22?,27+,28-,29-,30+/m0/s1 |
| InChIKey | JEVWKUGSMMMBBV-PBGRPUSMSA-N |
| XLogP | 4.71 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |