C32H45NO5 — CID 88988517
ethyl (4aS,6aS,6bR,8aS,9S,12aS,14aS,14bR)-10,14a-dihydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-14-oxo-3,4,5,6,7,8,8a,9,12,14b-decahydro-1H-picene-4a-carboxylate (PubChem CID 88988517) has the molecular formula C32H45NO5 and a molecular weight of 523.71 g/mol. Its IUPAC name is ethyl (4aS,6aS,6bR,8aS,9S,12aS,14aS,14bR)-10,14a-dihydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-14-oxo-3,4,5,6,7,8,8a,9,12,14b-decahydro-1H-picene-4a-carboxylate.
| Compound Name | ethyl (4aS,6aS,6bR,8aS,9S,12aS,14aS,14bR)-10,14a-dihydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-14-oxo-3,4,5,6,7,8,8a,9,12,14b-decahydro-1H-picene-4a-carboxylate |
|---|---|
| PubChem CID | 88988517 |
| Molecular Formula | C32H45NO5 |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.33 |
| IUPAC Name | ethyl (4aS,6aS,6bR,8aS,9S,12aS,14aS,14bR)-10,14a-dihydroxy-11-isocyano-2,2,6a,6b,9,12a-hexamethyl-14-oxo-3,4,5,6,7,8,8a,9,12,14b-decahydro-1H-picene-4a-carboxylate |
| SMILES | [C-]#[N+]C1=C(O)[C@@H](C)[C@@H]2CC[C@]3(C)C(=CC(=O)[C@]4(O)[C@@H]5CC(C)(C)CC[C@]5(C(=O)OCC)CC[C@@]34C)[C@@]2(C)C1 |
| InChI | InChI=1S/C32H45NO5/c1-9-38-26(36)31-14-12-27(3,4)18-23(31)32(37)24(34)16-22-28(5)17-21(33-8)25(35)19(2)20(28)10-11-29(22,6)30(32,7)13-15-31/h16,19-20,23,35,37H,9-15,17-18H2,1-7H3/t19-,20-,23+,28-,29+,30-,31-,32+/m0/s1 |
| InChIKey | ARRYTLYMLDOOAV-NUUJBSNOSA-N |
| XLogP | 6.55 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|