C17H20N4O — CID 153279252
(4aR,8aR)-7-isocyano-5,5,8a-trimethyl-2-pyrimidin-2-yl-1,3,4,4a-tetrahydroisoquinolin-6-one (PubChem CID 153279252) has the molecular formula C17H20N4O and a molecular weight of 296.37 g/mol. Its IUPAC name is (4aR,8aR)-7-isocyano-5,5,8a-trimethyl-2-pyrimidin-2-yl-1,3,4,4a-tetrahydroisoquinolin-6-one.
| Compound Name | (4aR,8aR)-7-isocyano-5,5,8a-trimethyl-2-pyrimidin-2-yl-1,3,4,4a-tetrahydroisoquinolin-6-one |
|---|---|
| PubChem CID | 153279252 |
| Molecular Formula | C17H20N4O |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | (4aR,8aR)-7-isocyano-5,5,8a-trimethyl-2-pyrimidin-2-yl-1,3,4,4a-tetrahydroisoquinolin-6-one |
| SMILES | [C-]#[N+]C1=C[C@]2(C)CN(c3ncccn3)CC[C@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C17H20N4O/c1-16(2)13-6-9-21(15-19-7-5-8-20-15)11-17(13,3)10-12(18-4)14(16)22/h5,7-8,10,13H,6,9,11H2,1-3H3/t13-,17+/m0/s1 |
| InChIKey | FCNVVMRMZOCARC-SUMWQHHRSA-N |
| XLogP | 2.72 |
| TPSA | 50.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|