C17H22N2O2 — CID 153279278
(4aS,8aS)-2-(cyclopropanecarbonyl)-7-isocyano-5,5,8a-trimethyl-1,3,4,4a-tetrahydroisoquinolin-6-one (PubChem CID 153279278) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is (4aS,8aS)-2-(cyclopropanecarbonyl)-7-isocyano-5,5,8a-trimethyl-1,3,4,4a-tetrahydroisoquinolin-6-one.
| Compound Name | (4aS,8aS)-2-(cyclopropanecarbonyl)-7-isocyano-5,5,8a-trimethyl-1,3,4,4a-tetrahydroisoquinolin-6-one |
|---|---|
| PubChem CID | 153279278 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (4aS,8aS)-2-(cyclopropanecarbonyl)-7-isocyano-5,5,8a-trimethyl-1,3,4,4a-tetrahydroisoquinolin-6-one |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)CN(C(=O)C3CC3)CC[C@@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C17H22N2O2/c1-16(2)13-7-8-19(15(21)11-5-6-11)10-17(13,3)9-12(18-4)14(16)20/h9,11,13H,5-8,10H2,1-3H3/t13-,17+/m1/s1 |
| InChIKey | ZHMFTPSULWNKJO-DYVFJYSZSA-N |
| XLogP | 2.66 |
| TPSA | 41.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|