C13H24N2OS — CID 120819844
(4-amino-3,3-dimethylpiperidin-1-yl)-(thian-4-yl)methanone (PubChem CID 120819844) has the molecular formula C13H24N2OS and a molecular weight of 256.41 g/mol. Its IUPAC name is (4-amino-3,3-dimethylpiperidin-1-yl)-(thian-4-yl)methanone.
| Compound Name | (4-amino-3,3-dimethylpiperidin-1-yl)-(thian-4-yl)methanone |
|---|---|
| PubChem CID | 120819844 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | (4-amino-3,3-dimethylpiperidin-1-yl)-(thian-4-yl)methanone |
| SMILES | CC1(C)CN(C(=O)C2CCSCC2)CCC1N |
| InChI | InChI=1S/C13H24N2OS/c1-13(2)9-15(6-3-11(13)14)12(16)10-4-7-17-8-5-10/h10-11H,3-9,14H2,1-2H3 |
| InChIKey | REQKMGBVIMJQDO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |