methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate

C9H18N2O2 — CID 115269783

IUPACmethyl 4-amino-3,3-dimethylpiperidine-1-carboxylate
SMILESCOC(=O)N1CCC(N)C(C)(C)C1
InChIInChI=1S/C9H18N2O2/c1-9(2)6-11(8(12)13-3)5-4-7(9)10/h7H,4-6,10H2,1-3H3
InChIKeyQHWSAVOJUMUHKS-UHFFFAOYSA-N
MW186.25 g/mol
LogP0.81
Rot. Bonds

About methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate

methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate (PubChem CID 115269783) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate.

Molecular Properties

Compound Namemethyl 4-amino-3,3-dimethylpiperidine-1-carboxylate
PubChem CID115269783
Molecular FormulaC9H18N2O2
Molecular Weight186.25 g/mol
Exact Mass186.14
IUPAC Namemethyl 4-amino-3,3-dimethylpiperidine-1-carboxylate
SMILESCOC(=O)N1CCC(N)C(C)(C)C1
InChIInChI=1S/C9H18N2O2/c1-9(2)6-11(8(12)13-3)5-4-7(9)10/h7H,4-6,10H2,1-3H3
InChIKeyQHWSAVOJUMUHKS-UHFFFAOYSA-N
XLogP0.81
TPSA55.56 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.25
LogP ≤ 50.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate?
The IUPAC name of methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate (CID 115269783) is methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate.
What is the SMILES notation for methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate?
The canonical SMILES for methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate is COC(=O)N1CCC(N)C(C)(C)C1.
What is the InChIKey of methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate?
The InChIKey is QHWSAVOJUMUHKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-9(2)6-11(8(12)13-3)5-4-7(9)10/h7H,4-6,10H2,1-3H3.
What are the key properties of methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate?
methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate has a molecular weight of 186.25 g/mol, XLogP of 0.81, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate is sourced from PubChem (CID 115269783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).