C9H18N2O2 — CID 115269783
methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate (PubChem CID 115269783) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate.
| Compound Name | methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 115269783 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | methyl 4-amino-3,3-dimethylpiperidine-1-carboxylate |
| SMILES | COC(=O)N1CCC(N)C(C)(C)C1 |
| InChI | InChI=1S/C9H18N2O2/c1-9(2)6-11(8(12)13-3)5-4-7(9)10/h7H,4-6,10H2,1-3H3 |
| InChIKey | QHWSAVOJUMUHKS-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |