C14H17NO3 — CID 153302243
(2S,4aR,8aS)-6-isocyano-2,4a,8,8-tetramethyl-4,8a-dihydrochromene-3,7-dione (PubChem CID 153302243) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (2S,4aR,8aS)-6-isocyano-2,4a,8,8-tetramethyl-4,8a-dihydrochromene-3,7-dione.
| Compound Name | (2S,4aR,8aS)-6-isocyano-2,4a,8,8-tetramethyl-4,8a-dihydrochromene-3,7-dione |
|---|---|
| PubChem CID | 153302243 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (2S,4aR,8aS)-6-isocyano-2,4a,8,8-tetramethyl-4,8a-dihydrochromene-3,7-dione |
| SMILES | [C-]#[N+]C1=C[C@@]2(C)CC(=O)[C@H](C)O[C@@H]2C(C)(C)C1=O |
| InChI | InChI=1S/C14H17NO3/c1-8-10(16)7-14(4)6-9(15-5)11(17)13(2,3)12(14)18-8/h6,8,12H,7H2,1-4H3/t8-,12+,14-/m0/s1 |
| InChIKey | DGCYIFYGAKVREM-PELMWDNLSA-N |
| XLogP | 2.15 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|