About (2R,5S)-2,5-di(propan-2-yl)oxolane
(2R,5S)-2,5-di(propan-2-yl)oxolane (PubChem CID 12641398) has the molecular formula C10H20O
and a molecular weight of 156.27 g/mol. Its IUPAC name is (2R,5S)-2,5-di(propan-2-yl)oxolane.
Molecular Properties
| Compound Name | (2R,5S)-2,5-di(propan-2-yl)oxolane |
| PubChem CID | 12641398 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | (2R,5S)-2,5-di(propan-2-yl)oxolane |
| SMILES | CC(C)[C@@H]1CC[C@H](C(C)C)O1 |
| InChI | InChI=1S/C10H20O/c1-7(2)9-5-6-10(11-9)8(3)4/h7-10H,5-6H2,1-4H3/t9-,10+ |
| InChIKey | RHXMWPWNZVBGBJ-AOOOYVTPSA-N |
| XLogP | 2.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,5S)-2,5-di(propan-2-yl)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-2,5-di(propan-2-yl)oxolane?
The IUPAC name of (2R,5S)-2,5-di(propan-2-yl)oxolane (CID 12641398) is (2R,5S)-2,5-di(propan-2-yl)oxolane.
What is the SMILES notation for (2R,5S)-2,5-di(propan-2-yl)oxolane?
The canonical SMILES for (2R,5S)-2,5-di(propan-2-yl)oxolane is CC(C)[C@@H]1CC[C@H](C(C)C)O1.
What is the InChIKey of (2R,5S)-2,5-di(propan-2-yl)oxolane?
The InChIKey is RHXMWPWNZVBGBJ-AOOOYVTPSA-N. The full InChI is InChI=1S/C10H20O/c1-7(2)9-5-6-10(11-9)8(3)4/h7-10H,5-6H2,1-4H3/t9-,10+.
What are the key properties of (2R,5S)-2,5-di(propan-2-yl)oxolane?
(2R,5S)-2,5-di(propan-2-yl)oxolane has a molecular weight of 156.27 g/mol, XLogP of 2.85, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-2,5-di(propan-2-yl)oxolane is sourced from PubChem (CID 12641398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).