C12H24O — CID 144905870
3-methyl-2,6-di(propan-2-yl)oxane (PubChem CID 144905870) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is 3-methyl-2,6-di(propan-2-yl)oxane.
| Compound Name | 3-methyl-2,6-di(propan-2-yl)oxane |
|---|---|
| PubChem CID | 144905870 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 3-methyl-2,6-di(propan-2-yl)oxane |
| SMILES | CC(C)C1CCC(C)C(C(C)C)O1 |
| InChI | InChI=1S/C12H24O/c1-8(2)11-7-6-10(5)12(13-11)9(3)4/h8-12H,6-7H2,1-5H3 |
| InChIKey | IQGZOANBASTXLN-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |