C10H22 — CID 143728444
1,2-dimethylcyclobutane;2-methylpropane (PubChem CID 143728444) has the molecular formula C10H22 and a molecular weight of 142.29 g/mol. Its IUPAC name is 1,2-dimethylcyclobutane;2-methylpropane.
| Compound Name | 1,2-dimethylcyclobutane;2-methylpropane |
|---|---|
| PubChem CID | 143728444 |
| Molecular Formula | C10H22 |
| Molecular Weight | 142.29 g/mol |
| Exact Mass | 142.17 |
| IUPAC Name | 1,2-dimethylcyclobutane;2-methylpropane |
| SMILES | CC(C)C.CC1CCC1C |
| InChI | InChI=1S/C6H12.C4H10/c1-5-3-4-6(5)2;1-4(2)3/h5-6H,3-4H2,1-2H3;4H,1-3H3 |
| InChIKey | LEKZOIXTSYCBNS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.29 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |