C7H17BO2 — CID 90968222
1,2-dimethylcyclobutane;methylboronic acid (PubChem CID 90968222) has the molecular formula C7H17BO2 and a molecular weight of 144.02 g/mol. Its IUPAC name is 1,2-dimethylcyclobutane;methylboronic acid.
| Compound Name | 1,2-dimethylcyclobutane;methylboronic acid |
|---|---|
| PubChem CID | 90968222 |
| Molecular Formula | C7H17BO2 |
| Molecular Weight | 144.02 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | 1,2-dimethylcyclobutane;methylboronic acid |
| SMILES | CB(O)O.CC1CCC1C |
| InChI | InChI=1S/C6H12.CH5BO2/c1-5-3-4-6(5)2;1-2(3)4/h5-6H,3-4H2,1-2H3;3-4H,1H3 |
| InChIKey | RGNKHUUSPOQVJW-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.02 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|