C12H22 — CID 91552917
1,2,4-trimethyl-3-prop-1-en-2-ylcyclohexane (PubChem CID 91552917) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is 1,2,4-trimethyl-3-prop-1-en-2-ylcyclohexane.
| Compound Name | 1,2,4-trimethyl-3-prop-1-en-2-ylcyclohexane |
|---|---|
| PubChem CID | 91552917 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 1,2,4-trimethyl-3-prop-1-en-2-ylcyclohexane |
| SMILES | C=C(C)C1C(C)CCC(C)C1C |
| InChI | InChI=1S/C12H22/c1-8(2)12-10(4)7-6-9(3)11(12)5/h9-12H,1,6-7H2,2-5H3 |
| InChIKey | MDIIOUQIGJYDAO-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|