C22H40O2 — CID 159922825
2,4-dimethyl-3-prop-1-en-2-ylcyclohexan-1-ol;2,5-dimethyl-3-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 159922825) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is 2,4-dimethyl-3-prop-1-en-2-ylcyclohexan-1-ol;2,5-dimethyl-3-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | 2,4-dimethyl-3-prop-1-en-2-ylcyclohexan-1-ol;2,5-dimethyl-3-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 159922825 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | 2,4-dimethyl-3-prop-1-en-2-ylcyclohexan-1-ol;2,5-dimethyl-3-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)C1C(C)CCC(O)C1C.C=C(C)C1CC(C)CC(O)C1C |
| InChI | InChI=1S/2C11H20O/c1-7(2)10-5-8(3)6-11(12)9(10)4;1-7(2)11-8(3)5-6-10(12)9(11)4/h2*8-12H,1,5-6H2,2-4H3 |
| InChIKey | NYPZNAQBYJABCC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|