C10H17ClO — CID 71333601
2-chloro-3-methyl-6-prop-1-en-2-ylcyclohexan-1-ol (PubChem CID 71333601) has the molecular formula C10H17ClO and a molecular weight of 188.70 g/mol. Its IUPAC name is 2-chloro-3-methyl-6-prop-1-en-2-ylcyclohexan-1-ol.
| Compound Name | 2-chloro-3-methyl-6-prop-1-en-2-ylcyclohexan-1-ol |
|---|---|
| PubChem CID | 71333601 |
| Molecular Formula | C10H17ClO |
| Molecular Weight | 188.70 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 2-chloro-3-methyl-6-prop-1-en-2-ylcyclohexan-1-ol |
| SMILES | C=C(C)C1CCC(C)C(Cl)C1O |
| InChI | InChI=1S/C10H17ClO/c1-6(2)8-5-4-7(3)9(11)10(8)12/h7-10,12H,1,4-5H2,2-3H3 |
| InChIKey | NGYIRNJZLFJMGD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.70 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|