C12H24O — CID 79424372
3-(3,4-dimethylcyclohexyl)butan-2-ol (PubChem CID 79424372) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is 3-(3,4-dimethylcyclohexyl)butan-2-ol.
| Compound Name | 3-(3,4-dimethylcyclohexyl)butan-2-ol |
|---|---|
| PubChem CID | 79424372 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | 3-(3,4-dimethylcyclohexyl)butan-2-ol |
| SMILES | CC(O)C(C)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C12H24O/c1-8-5-6-12(7-9(8)2)10(3)11(4)13/h8-13H,5-7H2,1-4H3 |
| InChIKey | GGMDBTDWGKMPAG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |