C10H20N2O — CID 64990996
2-amino-2-(3,4-dimethylcyclohexyl)acetamide (PubChem CID 64990996) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 2-amino-2-(3,4-dimethylcyclohexyl)acetamide.
| Compound Name | 2-amino-2-(3,4-dimethylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 64990996 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 2-amino-2-(3,4-dimethylcyclohexyl)acetamide |
| SMILES | CC1CCC(C(N)C(N)=O)CC1C |
| InChI | InChI=1S/C10H20N2O/c1-6-3-4-8(5-7(6)2)9(11)10(12)13/h6-9H,3-5,11H2,1-2H3,(H2,12,13) |
| InChIKey | VWNOQLIKUQZYJU-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |