C12H24N2 — CID 105202513
[cyclopropyl-(3,4-dimethylcyclohexyl)methyl]hydrazine (PubChem CID 105202513) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is [cyclopropyl-(3,4-dimethylcyclohexyl)methyl]hydrazine.
| Compound Name | [cyclopropyl-(3,4-dimethylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105202513 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | [cyclopropyl-(3,4-dimethylcyclohexyl)methyl]hydrazine |
| SMILES | CC1CCC(C(NN)C2CC2)CC1C |
| InChI | InChI=1S/C12H24N2/c1-8-3-4-11(7-9(8)2)12(14-13)10-5-6-10/h8-12,14H,3-7,13H2,1-2H3 |
| InChIKey | XNMZGMWOIOEJPQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|