About N-[cycloheptyl-(3,4-dimethylcyclohexyl)methyl]propan-1-amine
N-[cycloheptyl-(3,4-dimethylcyclohexyl)methyl]propan-1-amine (PubChem CID 65399657) has the molecular formula C19H37N
and a molecular weight of 279.51 g/mol. Its IUPAC name is N-[cycloheptyl-(3,4-dimethylcyclohexyl)methyl]propan-1-amine.
Molecular Properties
| Compound Name | N-[cycloheptyl-(3,4-dimethylcyclohexyl)methyl]propan-1-amine |
| PubChem CID | 65399657 |
| Molecular Formula | C19H37N |
| Molecular Weight | 279.51 g/mol |
| Exact Mass | 279.29 |
| IUPAC Name | N-[cycloheptyl-(3,4-dimethylcyclohexyl)methyl]propan-1-amine |
| SMILES | CCCNC(C1CCCCCC1)C1CCC(C)C(C)C1 |
| InChI | InChI=1S/C19H37N/c1-4-13-20-19(17-9-7-5-6-8-10-17)18-12-11-15(2)16(3)14-18/h15-20H,4-14H2,1-3H3 |
| InChIKey | JCBUPOCNFOZXLF-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[cycloheptyl-(3,4-dimethylcyclohexyl)methyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[cycloheptyl-(3,4-dimethylcyclohexyl)methyl]propan-1-amine?
The IUPAC name of N-[cycloheptyl-(3,4-dimethylcyclohexyl)methyl]propan-1-amine (CID 65399657) is N-[cycloheptyl-(3,4-dimethylcyclohexyl)methyl]propan-1-amine.
What is the SMILES notation for N-[cycloheptyl-(3,4-dimethylcyclohexyl)methyl]propan-1-amine?
The canonical SMILES for N-[cycloheptyl-(3,4-dimethylcyclohexyl)methyl]propan-1-amine is CCCNC(C1CCCCCC1)C1CCC(C)C(C)C1.
What is the InChIKey of N-[cycloheptyl-(3,4-dimethylcyclohexyl)methyl]propan-1-amine?
The InChIKey is JCBUPOCNFOZXLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37N/c1-4-13-20-19(17-9-7-5-6-8-10-17)18-12-11-15(2)16(3)14-18/h15-20H,4-14H2,1-3H3.
What are the key properties of N-[cycloheptyl-(3,4-dimethylcyclohexyl)methyl]propan-1-amine?
N-[cycloheptyl-(3,4-dimethylcyclohexyl)methyl]propan-1-amine has a molecular weight of 279.51 g/mol, XLogP of 5.40, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[cycloheptyl-(3,4-dimethylcyclohexyl)methyl]propan-1-amine is sourced from PubChem (CID 65399657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).