C17H34N2 — CID 105231804
[(3,5-dimethylcyclohexyl)-(4,4-dimethylcyclohexyl)methyl]hydrazine (PubChem CID 105231804) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is [(3,5-dimethylcyclohexyl)-(4,4-dimethylcyclohexyl)methyl]hydrazine.
| Compound Name | [(3,5-dimethylcyclohexyl)-(4,4-dimethylcyclohexyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105231804 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | [(3,5-dimethylcyclohexyl)-(4,4-dimethylcyclohexyl)methyl]hydrazine |
| SMILES | CC1CC(C)CC(C(NN)C2CCC(C)(C)CC2)C1 |
| InChI | InChI=1S/C17H34N2/c1-12-9-13(2)11-15(10-12)16(19-18)14-5-7-17(3,4)8-6-14/h12-16,19H,5-11,18H2,1-4H3 |
| InChIKey | FEBBZWLXMGFFFZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|