C13H26N2 — CID 105235002
[(3,5-dimethylcyclohexyl)-(2-methylcyclopropyl)methyl]hydrazine (PubChem CID 105235002) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is [(3,5-dimethylcyclohexyl)-(2-methylcyclopropyl)methyl]hydrazine.
| Compound Name | [(3,5-dimethylcyclohexyl)-(2-methylcyclopropyl)methyl]hydrazine |
|---|---|
| PubChem CID | 105235002 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | [(3,5-dimethylcyclohexyl)-(2-methylcyclopropyl)methyl]hydrazine |
| SMILES | CC1CC(C)CC(C(NN)C2CC2C)C1 |
| InChI | InChI=1S/C13H26N2/c1-8-4-9(2)6-11(5-8)13(15-14)12-7-10(12)3/h8-13,15H,4-7,14H2,1-3H3 |
| InChIKey | RJUBICQGWAIQQR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|